For research use only. Not for therapeutic Use.
7-Hydroxyaristolochic acid A(Cat No.:I044958)is a hydroxylated derivative of aristolochic acid A, a nitrophenanthrene carboxylic acid naturally found in Aristolochia and Asarum species. It is known for its potent nephrotoxic and carcinogenic properties, primarily due to its ability to form DNA adducts that lead to mutations. The addition of a hydroxyl group at the 7-position may influence its bioactivity and metabolic profile. Like its parent compound, 7-hydroxyaristolochic acid A is associated with aristolochic acid nephropathy and urothelial cancers, making it a subject of toxicological concern and molecular studies on chemical-induced DNA damage.
CAS Number | 79185-75-4 |
Synonyms | 9-hydroxy-8-methoxy-6-nitronaphtho[2,1-g][1,3]benzodioxole-5-carboxylic acid |
Molecular Formula | C17H11NO8 |
Purity | ≥95% |
IUPAC Name | 9-hydroxy-8-methoxy-6-nitronaphtho[2,1-g][1,3]benzodioxole-5-carboxylic acid |
InChI | InChI=1S/C17H11NO8/c1-24-15-8-4-10(18(22)23)13-9(17(20)21)5-12-16(26-6-25-12)14(13)7(8)2-3-11(15)19/h2-5,19H,6H2,1H3,(H,20,21) |
InChIKey | UCLGCTLOEZZSLA-UHFFFAOYSA-N |
SMILES | COC1=C(C=CC2=C3C(=C(C=C21)[N+](=O)[O-])C(=CC4=C3OCO4)C(=O)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |