For research use only. Not for therapeutic Use.
7-hydroxy Warfarin is a metabolite of (-)-warfarin (Item No. <span class=/itemid/>13531</span>), which is a more potent vitamin K antagonist than (+)-warfarin (Item No. <span class=/itemid/>13526</span>). Both isomers of warfarin are metabolized by the cytochrome P450 isoform 2C9 (CYP2C9). Stereoselective metabolism also occurs, and CYP2C9 is the primary enzyme responsible for metabolism of (-)-warfarin to 7-hydroxy warfarin.
| CAS Number | 17834-03-6 |
| Synonyms | 4,7-Dihydroxy-3-(3-oxo-1-phenylbutyl)-2H-1-benzopyran-2-one; 3-(α-Acetonylbenzyl)-4,7-dihydroxycoumarin; |
| Molecular Formula | C19H16O5 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 4,7-dihydroxy-3-(3-oxo-1-phenylbutyl)chromen-2-one |
| InChI | InChI=1S/C19H16O5/c1-11(20)9-15(12-5-3-2-4-6-12)17-18(22)14-8-7-13(21)10-16(14)24-19(17)23/h2-8,10,15,21-22H,9H2,1H3 |
| InChIKey | SKFYEJMLNMTTJA-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(C1=CC=CC=C1)C2=C(C3=C(C=C(C=C3)O)OC2=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |