7-Hydroxy Mitragynine is a potent alkaloid derived from the Mitragyna speciosa plant, commonly known as Kratom. It is known for its powerful analgesic properties, significantly stronger than morphine, and acts primarily on opioid receptors in the brain. Due to its strong affinity for μ-opioid receptors, it is studied for its potential in pain management and its effects on opioid receptor signaling pathways. Research into 7-Hydroxy Mitragynine focuses on understanding its pharmacological profile, potential therapeutic uses, and risks of dependency. It plays a critical role in studies related to pain relief, opioid addiction, and alternative therapies.
| Catalog Number | R047880 |
| CAS Number | 174418-82-7 |
| Synonyms | (αE,2S,3S,7aS,12bS)-3-Ethyl-1,2,3,4,6,7,7a,12b-octahydro-7a-hydroxy-8-methoxy-α-(methoxymethylene)indolo[2,3-a]quinolizine-2-acetic Acid Methyl Ester; (7α,16E,20β)-?1,2,16,17-Tetradehydro-2,7-dihydro-7-hydroxy-9,17-dimethoxycorynan-16-carboxylic acid |
| Molecular Formula | C23H30N2O5 |
| Purity | 98% |
| Appearance | A crystalline solid |
| Storage | -20°C |
| IUPAC Name | methyl (E)-2-[(2S,3S,7aS,12bS)-3-ethyl-7a-hydroxy-8-methoxy-2,3,4,6,7,12b-hexahydro-1H-indolo[2,3-a]quinolizin-2-yl]-3-methoxyprop-2-enoate |
| InChI | InChI=1S/C23H30N2O5/c1-5-14-12-25-10-9-23(27)20-17(7-6-8-19(20)29-3)24-21(23)18(25)11-15(14)16(13-28-2)22(26)30-4/h6-8,13-15,18,27H,5,9-12H2,1-4H3/b16-13+/t14-,15+,18+,23+/m1/s1 |
| InChIKey | RYENLSMHLCNXJT-CYXFISRXSA-N |
| SMILES | CCC1CN2CCC3(C(=NC4=C3C(=CC=C4)OC)C2CC1C(=COC)C(=O)OC)O |
