For research use only. Not for therapeutic Use.
7-Fluorobenzo[c][1,2]oxaborol-1(3H)-ol(Cat No.:L007795), is a chemical compound with the molecular formula C7H6BFO2. This compound belongs to the class of boronic acids, which are essential reagents in organic synthesis and medicinal chemistry due to their ability to form stable complexes with various organic molecules. The presence of a boron atom and a fluorine atom in the structure suggests potential applications in Suzuki-Miyaura cross-coupling reactions, where boronic acids are widely used substrates. These reactions are pivotal in the synthesis of biaryl compounds, which are prevalent motifs in pharmaceuticals, agrochemicals, and materials science.
CAS Number | 174671-93-3 |
Molecular Formula | C7H6BFO2 |
Purity | ≥95% |
IUPAC Name | 7-fluoro-1-hydroxy-3H-2,1-benzoxaborole |
InChI | InChI=1S/C7H6BFO2/c9-6-3-1-2-5-4-11-8(10)7(5)6/h1-3,10H,4H2 |
InChIKey | LIGKOZHDSGAHME-UHFFFAOYSA-N |
SMILES | B1(C2=C(CO1)C=CC=C2F)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |