For research use only. Not for therapeutic Use.
7-Deazahypoxanthine (Cat No. : R001016) is a purine analog in which the nitrogen at position 7 of the purine ring is replaced by a carbon atom, resulting in altered electronic and hydrogen-bonding properties. Structurally similar to hypoxanthine, this compound plays a role in nucleic acid research, particularly in studying base-pairing dynamics and enzyme specificity. It is used in the synthesis of modified nucleosides and nucleotides, which can enhance the stability or alter the biological recognition of DNA and RNA, with potential applications in drug discovery and biotechnology.
| CAS Number | 3680-71-5 |
| Synonyms | 7-Deaza-6-hydroxy Purine; 3,7-Dihydro-4H-pyrrolo[2,3-d]pyrimidin-4-one; NSC 124164; NSC 59251; |
| Molecular Formula | C6H5N3O |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 1,7-dihydropyrrolo[2,3-d]pyrimidin-4-one |
| InChI | InChI=1S/C6H5N3O/c10-6-4-1-2-7-5(4)8-3-9-6/h1-3H,(H2,7,8,9,10) |
| InChIKey | FBMZEITWVNHWJW-UHFFFAOYSA-N |
| SMILES | C1=CNC2=C1C(=O)N=CN2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
