For research use only. Not for therapeutic Use.
7-Chloroquinaldine is a halogenated derivative of quinaldine, characterized by a chlorine atom at the 7-position of the quinoline ring. This compound is of interest in organic synthesis and medicinal chemistry due to its potential biological activities, including antimicrobial and antimalarial properties. The chlorine substitution enhances its reactivity, making it a valuable building block for developing various pharmaceuticals and agrochemicals. Research focuses on exploring its therapeutic potential, structural modifications, and applications in the synthesis of bioactive compounds.
CAS Number | 4965-33-7 |
Synonyms | 7-Chloro-2-methylquinoline |
Molecular Formula | C10H8ClN |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | 7-chloro-2-methylquinoline |
InChI | InChI=1S/C10H8ClN/c1-7-2-3-8-4-5-9(11)6-10(8)12-7/h2-6H,1H3 |
InChIKey | WQZQFYRSYLXBGP-UHFFFAOYSA-N |
SMILES | CC1=NC2=C(C=C1)C=CC(=C2)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |