7-Bromochroman-4-amine HCl(CAT: L000581) is a compound of significance in the field of organic chemistry and pharmaceutical research. This chemical serves as a key intermediate for the synthesis of various organic molecules, particularly in the development of pharmaceuticals and bioactive compounds. Its unique structure, with a bromochroman-4-amine and hydrochloride salt form, offers opportunities for structural modification and the creation of novel drugs with potential therapeutic benefits.
Catalog Number | L000581 |
CAS Number | 2307737-83-1 |
Molecular Formula | C9H11BrClNO |
Purity | 95% |
IUPAC Name | 7-bromo-3,4-dihydro-2H-chromen-4-amine;hydrochloride |
InChI | InChI=1S/C9H10BrNO.ClH/c10-6-1-2-7-8(11)3-4-12-9(7)5-6;/h1-2,5,8H,3-4,11H2;1H |
InChIKey | BVJCAWWHYBICLV-UHFFFAOYSA-N |