For research use only. Not for therapeutic Use.
7-Bromo-2-chloro-5H-pyrrolo[3,2-d]pyrimidine(CAT: L024304) is a high-purity heterocyclic compound featuring bromine and chlorine substitutions on a pyrrolo[3,2-d]pyrimidine core. This versatile molecule is widely utilized in pharmaceutical and chemical research, particularly as a building block for synthesizing bioactive compounds and advanced organic frameworks. Its unique structure and reactivity make it valuable for medicinal chemistry applications, including the development of novel therapeutic agents and kinase inhibitors. With reliable quality and excellent stability, 7-Bromo-2-chloro-5H-pyrrolo[3,2-d]pyrimidine supports innovative research in drug discovery, organic synthesis, and material science.
CAS Number | 1429882-36-9 |
Molecular Formula | C6H3BrClN3 |
Purity | ≥95% |
IUPAC Name | 7-bromo-2-chloro-5H-pyrrolo[3,2-d]pyrimidine |
InChI | InChI=1S/C6H3BrClN3/c7-3-1-9-4-2-10-6(8)11-5(3)4/h1-2,9H |
InChIKey | XVPYDBHFZKKIDV-UHFFFAOYSA-N |
SMILES | C1=C(C2=NC(=NC=C2N1)Cl)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |