For research use only. Not for therapeutic Use.
7-(Benzyloxy)-6-methoxyquinolin-4-ol(Cat No.:L043235)is a quinoline derivative featuring benzyloxy and methoxy groups, along with a hydroxyl group at the 4-position. This compound is significant in organic synthesis, particularly in medicinal chemistry, where it serves as a key intermediate in the development of complex molecules with potential therapeutic applications. The presence of both electron-donating and electron-withdrawing groups on the quinoline ring allows for selective modifications, making it a versatile building block. Its role in drug discovery and research underscores its importance in advancing pharmaceutical development.
CAS Number | 205448-29-9 |
Molecular Formula | C17H15NO3 |
Purity | ≥95% |
IUPAC Name | 6-methoxy-7-phenylmethoxy-1H-quinolin-4-one |
InChI | InChI=1S/C17H15NO3/c1-20-16-9-13-14(18-8-7-15(13)19)10-17(16)21-11-12-5-3-2-4-6-12/h2-10H,11H2,1H3,(H,18,19) |
InChIKey | OXRDTRDGXMHOOV-UHFFFAOYSA-N |
SMILES | COC1=C(C=C2C(=C1)C(=O)C=CN2)OCC3=CC=CC=C3 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |