For research use only. Not for therapeutic Use.
7-Benzyl-1-oxo-2,7-diazaspiro[3.5]nonane is an organic compound with the formula C12H16N2O. It features a spirocyclic structure, consisting of a nonane ring fused with two nitrogen-containing heterocycles, one at the 2-position and the other at the 7-position. The molecule has a benzyl group (-CH2C6H5) at the 7-position and a carbonyl group (-C=O) at the 1-position. This compound may be of interest in medicinal chemistry for its potential bioactivity or as an intermediate in synthetic chemistry.
| CAS Number | 1334536-88-7 |
| Molecular Formula | C14H18N2O |
| Purity | ≥95% |
| IUPAC Name | 7-benzyl-2,7-diazaspiro[3.5]nonan-3-one |
| InChI | InChI=1S/C14H18N2O/c17-13-14(11-15-13)6-8-16(9-7-14)10-12-4-2-1-3-5-12/h1-5H,6-11H2,(H,15,17) |
| InChIKey | DGBWUOGTMKZEEP-UHFFFAOYSA-N |
| SMILES | C1CN(CCC12CNC2=O)CC3=CC=CC=C3 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |