For research use only. Not for therapeutic Use.
7-Benzothiazolecarboxylic Acid is a heterocyclic aromatic compound with significant applications in medicinal chemistry and organic synthesis. Featuring a benzothiazole ring and a carboxylic acid functional group, this compound exhibits notable biological activities, including antimicrobial and anti-inflammatory properties. Its structure allows for diverse chemical modifications, enabling the synthesis of various derivatives with enhanced pharmacological profiles. Researchers explore 7-Benzothiazolecarboxylic Acid for its potential in developing novel therapeutic agents and agrochemicals. Additionally, its reactivity makes it suitable for use in coupling reactions and as a building block in the synthesis of more complex molecular architectures in chemical research.
CAS Number | 677304-83-5 |
Synonyms | 1,3-Benzothiazole-7-carboxylic Acid |
Molecular Formula | C8H5NO2S |
Purity | ≥95% |
Storage | Desiccate at +4C |
IUPAC Name | 1,3-benzothiazole-7-carboxylic acid |
InChI | InChI=1S/C8H5NO2S/c10-8(11)5-2-1-3-6-7(5)12-4-9-6/h1-4H,(H,10,11) |
InChIKey | ORSZGLLQNYSMNO-UHFFFAOYSA-N |
SMILES | C1=CC(=C2C(=C1)N=CS2)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |