Home
>
Reference Standards>Chemical Reagents> 7-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)heptanoic acid
For research use only. Not for therapeutic Use.
7-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)heptanoic acid(Cat No.:L007468), is a chemical compound with diverse applications in scientific research. This compound is characterized by a heptanoic acid backbone with a pyrrole-1-yl group at the 7th carbon, featuring two carbonyl groups at positions 2 and 5 of the pyrrole ring. Its unique structure makes it valuable in studies related to organic synthesis and drug discovery. Researchers use it as a building block to create complex molecules for pharmaceutical development, exploiting its specific reactivity and functional groups.
CAS Number | 90267-85-9 |
Molecular Formula | C11H15NO4 |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | 7-(2,5-dioxopyrrol-1-yl)heptanoic acid |
InChI | InChI=1S/C11H15NO4/c13-9-6-7-10(14)12(9)8-4-2-1-3-5-11(15)16/h6-7H,1-5,8H2,(H,15,16) |
InChIKey | DHELHOUTNAEDJP-UHFFFAOYSA-N |
SMILES | C1=CC(=O)N(C1=O)CCCCCCC(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |