For research use only. Not for therapeutic Use.
6,7-Dimethoxy-1H-indole(Cat No.:L030001)is a methoxylated indole derivative featuring methoxy groups at the 6- and 7-positions of the indole ring system. This compound is commonly used in medicinal and synthetic organic chemistry as a building block for the development of bioactive molecules, including CNS agents, enzyme inhibitors, and receptor ligands. The methoxy groups enhance the compound’s lipophilicity and electronic properties, potentially improving biological activity and membrane permeability. Its indole core, a privileged structure in drug discovery, makes it valuable for constructing complex heterocycles in pharmaceutical, agrochemical, and natural product synthesis.
| CAS Number | 31165-13-6 |
| Molecular Formula | C10H11NO2 |
| Purity | ≥95% |
| IUPAC Name | 6,7-dimethoxy-1H-indole |
| InChI | InChI=1S/C10H11NO2/c1-12-8-4-3-7-5-6-11-9(7)10(8)13-2/h3-6,11H,1-2H3 |
| InChIKey | XYIMIJSUMIEFDG-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C(C=C1)C=CN2)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |