For research use only. Not for therapeutic Use.
653-47 hydrochloride（Cat No.:I044561）is the salt form of a bioactive small molecule known to function as a selective inhibitor of the Wnt/β-catenin signaling pathway. By disrupting β-catenin–mediated transcription, 653-47 hydrochloride modulates key cellular processes such as proliferation, differentiation, and apoptosis. This compound has been investigated for its therapeutic potential in cancers and fibrotic diseases where aberrant Wnt signaling plays a critical role. Preclinical studies indicate effective pathway suppression and antitumor activity. 653-47 hydrochloride is a valuable tool for probing Wnt pathway biology and developing targeted therapies against Wnt-driven pathologies.
| CAS Number | 1224567-46-7 |
| Synonyms | 3-(3-aminopropoxy)-N-(4-chloro-2-hydroxyphenyl)naphthalene-2-carboxamide;hydrochloride |
| Molecular Formula | C20H20Cl2N2O3 |
| Purity | ≥95% |
| IUPAC Name | 3-(3-aminopropoxy)-N-(4-chloro-2-hydroxyphenyl)naphthalene-2-carboxamide;hydrochloride |
| InChI | InChI=1S/C20H19ClN2O3.ClH/c21-15-6-7-17(18(24)12-15)23-20(25)16-10-13-4-1-2-5-14(13)11-19(16)26-9-3-8-22;/h1-2,4-7,10-12,24H,3,8-9,22H2,(H,23,25);1H |
| InChIKey | HESNWSHDEFHION-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C(=CC2=C1)C(=O)NC3=C(C=C(C=C3)Cl)O)OCCCN.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
