1. Home
  2. Product
  3. Chemical Reagents
  4. Heterocyclic Building Blocks
  5. 6-(Pyridin-3-yl)pyridin-3-amine

6-(Pyridin-3-yl)pyridin-3-amine - CAS 35989-06-1

6-(Pyridin-3-yl)pyridin-3-amine（Cat No.:L007658）, is a chemical compound featuring two pyridine rings with one of them substituted with an amine group at the 3-position and the other with a pyridin-3-yl group at the 6-position. This specific molecular structure is significant in organic synthesis and medicinal chemistry. Researchers utilize it as a key intermediate or building block in the creation of various organic molecules, especially in the development of pharmaceuticals and fine chemicals. Its versatile nature allows for diverse chemical modifications, making it valuable in the design and synthesis of novel compounds for drug discovery and research purposes, contributing to advancements in medicinal chemistry research.

Catalog Number: L007658

CAS Number: 35989-06-1

Molecular Formula: C10H9N3

Molecular Weight:171.20

Purity: ≥95%

Online inquiry

* For research use only. Not for human or veterinary use.


Property

Molecular Formula: C10H9N3
Molecular Weight171.20
Purity≥95%

Computed Descriptor

IUPAC Name6-pyridin-3-ylpyridin-3-amine
InChIInChI=1S/C10H9N3/c11-9-3-4-10(13-7-9)8-2-1-5-12-6-8/h1-7H,11H2
InChIKeyPAQALCKYBOJWEA-UHFFFAOYSA-N
SMILESC1=CC(=CN=C1)C2=NC=C(C=C2)N