For research use only. Not for therapeutic Use.
6-(Pyridin-2-yl)pyridazine-3-thiol (Cat.No:L003455) is a significant heterocyclic compound with diverse applications in medicinal chemistry. Its distinctive structure, containing pyridine and pyridazine rings, offers a versatile scaffold for drug development. This compound’s sulfur-containing thiol group further enhances its reactivity and pharmacological potential. It holds promise as a key building block for the synthesis of novel pharmaceutical agents, highlighting its importance in modern drug discovery endeavors.
Catalog Number | L003455 |
CAS Number | 1005036-25-8 |
Molecular Formula | C9H7N3S |
Purity | ≥95% |
IUPAC Name | 3-pyridin-2-yl-1H-pyridazine-6-thione |
InChI | InChI=1S/C9H7N3S/c13-9-5-4-8(11-12-9)7-3-1-2-6-10-7/h1-6H,(H,12,13) |
InChIKey | HBGYAZVOIPRLHX-UHFFFAOYSA-N |
SMILES | C1=CC=NC(=C1)C2=NNC(=S)C=C2 |