For research use only. Not for therapeutic Use.
6-Nitrobenzo[d]thiazol-2(3H)-one is a heterocyclic compound characterized by a thiazole ring fused to a benzene structure, with a nitro group at the 6-position and a carbonyl group in the 2-position. This unique arrangement imparts distinct electronic properties and reactivity, making it valuable in organic synthesis and medicinal chemistry. The nitro group can participate in electrophilic substitution reactions, while the carbonyl enhances the compound’s reactivity. This compound may serve as a key intermediate in developing pharmaceuticals and other bioactive compounds.
CAS Number | 28620-12-4 |
Molecular Formula | C7H4N2O3S |
Purity | ≥95% |
IUPAC Name | 6-nitro-3H-1,3-benzothiazol-2-one |
InChI | InChI=1S/C7H4N2O3S/c10-7-8-5-2-1-4(9(11)12)3-6(5)13-7/h1-3H,(H,8,10) |
InChIKey | QITPMSSAFSZYOP-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C=C1[N+](=O)[O-])SC(=O)N2 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |