Home
>
Chemical Reagents>Heterocyclic Building Blocks> 6-(Naphthalen-2-yl)-5-(pyridin-4-yl)pyridazin-3(2H)-one
For research use only. Not for therapeutic Use.
6-(Naphthalen-2-yl)-5-(pyridin-4-yl)pyridazin-3(2H)-one (Cat.No:L003696) is a notable chemical compound with diverse applications in medicinal chemistry. Its unique fused-ring structure imparts distinctive pharmacological properties, making it a promising scaffold for drug development. This compound’s specific arrangement of aromatic rings grants it potential in the design of novel pharmaceutical agents.
| CAS Number | 629623-78-5 |
| Molecular Formula | C19H13N3O |
| Purity | ≥95% |
| IUPAC Name | 3-naphthalen-2-yl-4-pyridin-4-yl-1H-pyridazin-6-one |
| InChI | InChI=1S/C19H13N3O/c23-18-12-17(14-7-9-20-10-8-14)19(22-21-18)16-6-5-13-3-1-2-4-15(13)11-16/h1-12H,(H,21,23) |
| InChIKey | LKRYTMQZENBLST-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C3=NNC(=O)C=C3C4=CC=NC=C4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |