For research use only. Not for therapeutic Use.
6-(Methylsulfonyl)quinolin-3-amine(Cat No.:L025909)is a heterocyclic compound featuring a quinoline core with a methylsulfonyl group at the 6-position and an amine group at the 3-position. This compound is used in pharmaceutical research and organic synthesis as a versatile intermediate in the development of biologically active molecules, including potential drug candidates. Its structure offers unique reactivity, particularly for sulfonylation and functional group modifications, making it valuable in creating complex molecules. Researchers in medicinal chemistry utilize this compound to explore novel therapeutic agents and synthetic pathways.
CAS Number | 1956382-07-2 |
Molecular Formula | C10H10N2O2S |
Purity | ≥95% |
IUPAC Name | 6-methylsulfonylquinolin-3-amine |
InChI | InChI=1S/C10H10N2O2S/c1-15(13,14)9-2-3-10-7(5-9)4-8(11)6-12-10/h2-6H,11H2,1H3 |
InChIKey | XHQADEVEEMSYQL-UHFFFAOYSA-N |
SMILES | CS(=O)(=O)C1=CC2=CC(=CN=C2C=C1)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |