For research use only. Not for therapeutic Use.
6-Methylbenzo[d]isoxazol-3(2H)-one is a heterocyclic compound featuring a methyl group attached to the benzene ring of a benzo[d]isoxazole structure. This compound is utilized in pharmaceutical research and synthetic chemistry due to its bioactive potential, often studied for its role in drug development and as a scaffold for the design of novel molecules. Its unique chemical structure may enable interactions with biological targets, contributing to its exploration in various therapeutic contexts, including anti-inflammatory and anticancer research.
| CAS Number | 66571-26-4 |
| Molecular Formula | C8H7NO2 |
| Purity | ≥95% |
| IUPAC Name | 6-methyl-1,2-benzoxazol-3-one |
| InChI | InChI=1S/C8H7NO2/c1-5-2-3-6-7(4-5)11-9-8(6)10/h2-4H,1H3,(H,9,10) |
| InChIKey | TZUHTZMWRNXWLN-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C(=O)NO2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |