For research use only. Not for therapeutic Use.
6-Methyl-8-nitro-4-oxochromene-3-carbaldehyde is a chromene derivative featuring a methyl group, nitro group, and formyl group attached to the chromene core. This compound is used as an intermediate in the synthesis of various biologically active molecules, including pharmaceuticals and agrochemicals. Its fused chromene ring system, combined with reactive functional groups, makes it useful in the preparation of heterocyclic compounds. It is particularly valuable for creating antioxidant, anti-inflammatory, and anticancer agents in medicinal chemistry research.
CAS Number | 879559-54-3 |
Molecular Formula | C11H7NO5 |
Purity | ≥95% |
IUPAC Name | 6-methyl-8-nitro-4-oxochromene-3-carbaldehyde |
InChI | InChI=1S/C11H7NO5/c1-6-2-8-10(14)7(4-13)5-17-11(8)9(3-6)12(15)16/h2-5H,1H3 |
InChIKey | SXWLMTKBGJSOBH-UHFFFAOYSA-N |
SMILES | CC1=CC(=C2C(=C1)C(=O)C(=CO2)C=O)[N+](=O)[O-] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |