Home
>
Reference Standards>Heterocyclic Building Blocks> 6-Methyl-2-phenyl-4,5-dihydropyridazin-3-one
For research use only. Not for therapeutic Use.
6-Methyl-2-phenyl-4,5-dihydropyridazin-3-one(Cat No.:M085246)is a high-purity heterocyclic compound widely used in pharmaceutical and chemical research. This molecule features a dihydropyridazinone core with a methyl group at the 6-position and a phenyl group at the 2-position, making it a valuable intermediate in the synthesis of bioactive compounds, including potential drug candidates. Its unique structure allows for selective reactivity, facilitating various chemical transformations. 6-Methyl-2-phenyl-4,5-dihydropyridazin-3-one is essential for precise synthetic applications, contributing to advancements in medicinal chemistry and innovative research.
CAS Number | 4578-58-9 |
Molecular Formula | C11H12N2O |
Purity | ≥95% |
IUPAC Name | 6-methyl-2-phenyl-4,5-dihydropyridazin-3-one |
InChI | InChI=1S/C11H12N2O/c1-9-7-8-11(14)13(12-9)10-5-3-2-4-6-10/h2-6H,7-8H2,1H3 |
InChIKey | KQVXOJQOQRTUDA-UHFFFAOYSA-N |
SMILES | CC1=NN(C(=O)CC1)C2=CC=CC=C2 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |