For research use only. Not for therapeutic Use.
6-Methoxyisoquinolin-4-amine(CAT: L000339) is a chemical compound with significance in the fields of pharmaceutical and organic chemistry. This compound, featuring a methoxy group attached to an isoquinoline core, is a valuable intermediate in the synthesis of pharmaceuticals. It plays a pivotal role in pharmaceutical research by serving as a key building block for the development of medications with various therapeutic applications.
CAS Number | 1780189-97-0 |
Molecular Formula | C10H10N2O |
Purity | ≥95% |
IUPAC Name | 6-methoxyisoquinolin-4-amine |
InChI | InChI=1S/C10H10N2O/c1-13-8-3-2-7-5-12-6-10(11)9(7)4-8/h2-6H,11H2,1H3 |
InChIKey | VIRYHFKACBTPCK-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |