For research use only. Not for therapeutic Use.
6-Methoxy-2-naphthaleneacetic acid(Cat No.:R006096), also known as Desmethyl Naproxen, is a naphthalene-based acetic acid derivative structurally related to the nonsteroidal anti-inflammatory drug (NSAID) naproxen. Lacking the methyl group on the α-carbon, it is often studied as a synthetic intermediate or metabolite in pharmaceutical research. The compound retains the carboxylic acid and methoxy functionalities that contribute to anti-inflammatory and analgesic activity. It is typically used in the development of NSAID analogs or in structure–activity relationship (SAR) studies. Desmethyl Naproxen is generally provided as a crystalline solid, soluble in organic solvents.
CAS Number | 23981-47-7 |
Synonyms | 2-(6-Methoxy-2-naphthyl)acetic Acid; 6-Methoxy-2-naphthylacetic Acid; 6-MNA; BRL 10720; Desmethyl Naproxen; |
Molecular Formula | C13H12O3 |
Purity | ≥95% |
Target | COX |
Solubility | Soluble in DMSO |
Storage | Room temperature |
IUPAC Name | 2-(6-methoxynaphthalen-2-yl)acetic acid |
InChI | InChI=1S/C13H12O3/c1-16-12-5-4-10-6-9(7-13(14)15)2-3-11(10)8-12/h2-6,8H,7H2,1H3,(H,14,15) |
InChIKey | PHJFLPMVEFKEPL-UHFFFAOYSA-N |
SMILES | COC1=CC2=C(C=C1)C=C(C=C2)CC(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |