For research use only. Not for therapeutic Use.
6-Iodonordihydrocapsaicin(Cat No.:I010484)is a chemical derivative of capsaicin, the compound responsible for the spicy heat in chili peppers. It features an iodine atom substitution at the 6-position of the nordihydrocapsaicin molecule. This modification alters its pharmacological properties, potentially enhancing its bioactivity. 6-Iodonordihydrocapsaicin has been studied for its effects on pain relief, as it may act on capsaicin receptors, particularly the TRPV1 receptor, which is involved in pain perception and inflammation. It also holds potential in the development of novel therapies for pain management, though further studies are needed to fully understand its therapeutic efficacy and safety.
CAS Number | 859171-97-4 |
Molecular Formula | C17H26INO3 |
Purity | ≥95% |
Target | TRP Channel |
Solubility | Soluble to 50 mM in ethanol and to 100 mM in DMSO |
Storage | Store at RT |
IUPAC Name | N-[(4-hydroxy-2-iodo-5-methoxyphenyl)methyl]nonanamide |
InChI | InChI=1S/C17H26INO3/c1-3-4-5-6-7-8-9-17(21)19-12-13-10-16(22-2)15(20)11-14(13)18/h10-11,20H,3-9,12H2,1-2H3,(H,19,21) |
InChIKey | AAORACFZMYMFCG-UHFFFAOYSA-N |
SMILES | CCCCCCCCC(=O)NCC1=CC(=C(C=C1I)O)OC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |