For research use only. Not for therapeutic Use.
6-Hydroxy Monopropylheptylphthalate is a complex ester derived from phthalic acid, featuring a hydroxyl group and a propyl heptyl chain. This compound exists as a mixture of diastereomers, which may exhibit distinct physical and chemical properties. It is primarily studied for its potential applications as a plasticizer, enhancing the flexibility and durability of polymers. Additionally, its unique structure allows for compatibility with various materials, making it valuable in the development of sustainable alternatives in coatings, adhesives, and flexible plastics.
CAS Number | 1372605-11-2 |
Synonyms | OH-MiDP; 1,2-Benzenedicarboxylic Acid 1-(6-Hydroxy-2-propylheptyl) Ester, OH-MPHP |
Molecular Formula | C18H26O5 |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | 2-(6-hydroxy-2-propylheptoxy)carbonylbenzoic acid |
InChI | InChI=1S/C18H26O5/c1-3-7-14(9-6-8-13(2)19)12-23-18(22)16-11-5-4-10-15(16)17(20)21/h4-5,10-11,13-14,19H,3,6-9,12H2,1-2H3,(H,20,21) |
InChIKey | KNDRVUYMYPIFIU-UHFFFAOYSA-N |
SMILES | CCCC(CCCC(C)O)COC(=O)C1=CC=CC=C1C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |