<p>
<span style="color:#000000;"><span style="font-size:12px;"><span style="font-family:arial,helvetica,sans-serif;">(6)HELICENE (CAS 187-83-7) can be used in asymmetric polymerization of triphenylmethyl methacrylate by C2-chiral catalysts.</span></span></span></p>
| Catalog Number | M069153 |
| CAS Number | 187-83-7 |
| Molecular Formula | C26H16 |
| Purity | 95% |
| Storage | Room temperature |
| IUPAC Name | hexahelicene |
| InChI | InChI=1S/C26H16/c1-3-7-22-17(5-1)9-11-19-13-15-21-16-14-20-12-10-18-6-2-4-8-23(18)25(20)26(21)24(19)22/h1-16H |
| InChIKey | UOYPNWSDSPYOSN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=C2C4=C(C=C3)C=CC5=C4C6=CC=CC=C6C=C5 |
| Reference | 1.Kanoh, Sh. et al.: Journal of Polymer Science, Part A: Polymer Chemistry, Vol. 25, P: 1603-18 (1987) |
