For research use only. Not for therapeutic Use.
6-Fluoroindole（Cat No.:R044764）is a fluorinated aromatic heterocycle derived from indole, where a fluorine atom is substituted at the 6-position of the benzene ring. This modification enhances its chemical reactivity and biological relevance. Widely used as a building block in pharmaceutical synthesis, 6-Fluoroindole is instrumental in the development of kinase inhibitors, antimicrobial agents, and serotonin receptor ligands. Its electron-withdrawing fluorine atom can modulate bioactivity and metabolic stability, making it valuable in medicinal chemistry. Additionally, it serves as a key intermediate in creating fluorinated tryptophan analogs for structural biology and protein labeling applications.
| CAS Number | 399-51-9 |
| Synonyms | 6-Fluoro-1H-indole; NSC 520436 |
| Molecular Formula | C8H6FN |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 6-fluoro-1H-indole |
| InChI | InChI=1S/C8H6FN/c9-7-2-1-6-3-4-10-8(6)5-7/h1-5,10H |
| InChIKey | YYFFEPUCAKVRJX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=C1C=CN2)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
