For research use only. Not for therapeutic Use.
6-Fluoro-5-iodo-1H-indazole(Cat No.:M090381)is a halogenated indazole derivative featuring a fluorine atom at the 6-position and an iodine atom at the 5-position. This compound is significant in pharmaceutical research and organic synthesis as a building block for developing bioactive molecules, including potential drug candidates and ligands for receptor studies. The combination of fluorine and iodine enhances the compound’s reactivity and allows for diverse chemical modifications. Its high purity and structural versatility make it essential for advanced research in medicinal chemistry and drug development.
CAS Number | 1260384-77-7 |
Synonyms | 6-Fluoro-5-iodo-1H-indazole |
Molecular Formula | C7H4FIN2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 6-fluoro-5-iodo-1H-indazole |
InChI | InChI=1S/C7H4FIN2/c8-5-2-7-4(1-6(5)9)3-10-11-7/h1-3H,(H,10,11) |
InChIKey | IFAYDNUIYXDTJH-UHFFFAOYSA-N |
SMILES | C1=C2C=NNC2=CC(=C1I)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |