For research use only. Not for therapeutic Use.
6-Fluoro-3-(4-piperidinyl)-1,2-benzisoxazole Hydrochloride is a bioactive compound characterized by its unique benzisoxazole framework and piperidine substituent. This hydrochloride salt exhibits significant potential in medicinal chemistry, particularly in the development of novel therapeutics targeting neurological disorders. The presence of the fluorine atom enhances its pharmacological properties and metabolic stability. Researchers are exploring its efficacy as a selective ligand, contributing to advancements in drug discovery and therapeutic applications, particularly in central nervous system-related treatments.
CAS Number | 84163-13-3 |
Synonyms | 6-Fluoro-3-(4-piperidinyl)-1,2-benzisoxazole Monohydrochloride; 4-(6-Fluoro-1,2-benzisoxazol-3-yl)piperidine Hydrochloride; 6-Fluoro-3-(4-piperidinyl)-1,2-benzisoxazole Hydrochloride; 6-Fluoro-3-(4-piperidinyl)-1,2-benzisoxazole Monohydrochloride; 6- |
Molecular Formula | C12H14ClFN2O |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 6-fluoro-3-piperidin-4-yl-1,2-benzoxazole;hydrochloride |
InChI | InChI=1S/C12H13FN2O.ClH/c13-9-1-2-10-11(7-9)16-15-12(10)8-3-5-14-6-4-8;/h1-2,7-8,14H,3-6H2;1H |
InChIKey | CWPSRUREOSBKBQ-UHFFFAOYSA-N |
SMILES | C1CNCCC1C2=NOC3=C2C=CC(=C3)F.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |