For research use only, not for therapeutic use.
6-(Ethyl(3-isopropoxy-4-isopropylphenyl)amino)nicotinic acid (Cat.No:L003323) is a significant chemical compound utilized in medicinal chemistry. Its unique structure makes it a valuable intermediate in the synthesis of pharmaceutical agents, showcasing its importance in drug development, particularly in the creation of novel therapies and treatments.
| Catalog Number | L003323 |
| CAS Number | 1041186-79-1 |
| Molecular Formula | C20H26N2O3 |
| Purity | ≥95% |
| IUPAC Name | 6-(N-ethyl-4-propan-2-yl-3-propan-2-yloxyanilino)pyridine-3-carboxylic acid |
| InChI | InChI=1S/C20H26N2O3/c1-6-22(19-10-7-15(12-21-19)20(23)24)16-8-9-17(13(2)3)18(11-16)25-14(4)5/h7-14H,6H2,1-5H3,(H,23,24) |
| InChIKey | YHELAIIDVSNOPG-UHFFFAOYSA-N |
| SMILES | CCN(C1=CC(=C(C=C1)C(C)C)OC(C)C)C2=NC=C(C=C2)C(=O)O |
