For research use only. Not for therapeutic Use.
6-(Difluoromethyl)pyridin-3-amine(Cat No.:L012031)is a valuable compound used in pharmaceutical and chemical research. Featuring a difluoromethyl group at the 6-position and an amino group at the 3-position on a pyridine ring, this compound serves as a key intermediate in the synthesis of various bioactive molecules. Its unique structure allows for diverse chemical transformations, making it essential in medicinal chemistry for the development of new therapeutic agents. This compound supports innovative research in drug discovery, contributing to the exploration of novel chemical pathways and biological activities.
CAS Number | 913090-41-2 |
Molecular Formula | C6H6F2N2 |
Purity | ≥95% |
IUPAC Name | 6-(difluoromethyl)pyridin-3-amine |
InChI | InChI=1S/C6H6F2N2/c7-6(8)5-2-1-4(9)3-10-5/h1-3,6H,9H2 |
InChIKey | CHLQZHZHFXWMOV-UHFFFAOYSA-N |
SMILES | C1=CC(=NC=C1N)C(F)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |