For research use only. Not for therapeutic Use.
6-Demethoxylnobiletin(CAT: M129329) is a natural compound derived from citrus fruits, particularly from the peel of Citrus reticulata (tangerine). Its action target involves various biological activities due to its complex chemical structure. The mode of action includes potential anti-inflammatory, antioxidant, and anticancer effects. Pharmacologically, 6-Demethoxylnobiletin has shown promise in various medicinal applications, including its potential in reducing inflammation, its role as an antioxidant agent to combat oxidative stress, and its ability to inhibit the growth and proliferation of certain cancer cells. It is also being researched for its potential neuroprotective properties.
CAS Number | 17290-70-9 |
Molecular Formula | C20H20O7 |
Purity | ≥95% |
Target | Anti-infection |
Storage | -20°C |
IUPAC Name | 2-(3,4-dimethoxyphenyl)-5,7,8-trimethoxychromen-4-one |
InChI | InChI=1S/C20H20O7/c1-22-13-7-6-11(8-15(13)23-2)14-9-12(21)18-16(24-3)10-17(25-4)19(26-5)20(18)27-14/h6-10H,1-5H3 |
InChIKey | UYCWETIUOAGWIL-UHFFFAOYSA-N |
SMILES | COC1=C(C=C(C=C1)C2=CC(=O)C3=C(O2)C(=C(C=C3OC)OC)OC)OC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |