For research use only. Not for therapeutic Use.
(6-Chloropyridin-3-yl)(cyclopropyl)methanone(CAT: L021901) is a high-purity heterocyclic ketone widely utilized in pharmaceutical and organic synthesis research. Featuring a chlorinated pyridine ring and a cyclopropyl ketone moiety, this compound serves as a versatile intermediate for the development of bioactive molecules and complex organic compounds. It is particularly valuable in medicinal chemistry for exploring structure-activity relationships and designing novel therapeutic agents. With excellent stability and reactivity, (6-Chloropyridin-3-yl)(cyclopropyl)methanone ensures precision and reliability, making it an essential tool for innovative research and advanced synthetic applications.
| CAS Number | 872088-06-7 |
| Molecular Formula | C9H8ClNO |
| Purity | ≥95% |
| IUPAC Name | (6-chloropyridin-3-yl)-cyclopropylmethanone |
| InChI | InChI=1S/C9H8ClNO/c10-8-4-3-7(5-11-8)9(12)6-1-2-6/h3-6H,1-2H2 |
| InChIKey | HMTIMNJNXGOOTH-UHFFFAOYSA-N |
| SMILES | C1CC1C(=O)C2=CN=C(C=C2)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |