For research use only. Not for therapeutic Use.
6-Chloronicotinaldehyde(Cat No.:L041864)is a heterocyclic aromatic compound derived from nicotinaldehyde, featuring a chlorine atom at the 6-position of the pyridine ring and an aldehyde group at the 3-position. It appears as a pale yellow solid and serves as a versatile intermediate in pharmaceutical and agrochemical synthesis. The electron-withdrawing chlorine and aldehyde functionalities enable selective functionalization, making it useful in constructing more complex heterocycles. It is often employed in the synthesis of pyridine-based ligands, active pharmaceutical ingredients, and pesticide candidates, offering both reactivity and structural diversity for medicinal chemistry applications.
| CAS Number | 23100-12-1 |
| Molecular Formula | C6H4ClNO |
| Purity | ≥95% |
| IUPAC Name | 6-chloropyridine-3-carbaldehyde |
| InChI | InChI=1S/C6H4ClNO/c7-6-2-1-5(4-9)3-8-6/h1-4H |
| InChIKey | AFWWKZCPPRPDQK-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1C=O)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |