For research use only. Not for therapeutic Use.
6-Chloroindolizine(CAT: L029211) is a high-purity heterocyclic compound featuring a chlorinated indolizine scaffold. This compound is widely utilized in pharmaceutical and chemical research as a versatile building block for synthesizing bioactive molecules and advanced materials. The presence of the chlorine atom enhances its reactivity, making it suitable for various functionalization and coupling reactions. Its indolizine core, known for its biological relevance, supports applications in medicinal chemistry, particularly in drug discovery and development. With consistent quality and excellent stability, 6-Chloroindolizine is an essential reagent for innovative research in organic synthesis and material science.
CAS Number | 1632285-97-2 |
Molecular Formula | C8H6ClN |
Purity | ≥95% |
IUPAC Name | 6-chloroindolizine |
InChI | InChI=1S/C8H6ClN/c9-7-3-4-8-2-1-5-10(8)6-7/h1-6H |
InChIKey | MSNSGOOTOLRXBM-UHFFFAOYSA-N |
SMILES | C1=CN2C=C(C=CC2=C1)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |