Home
>
Chemical Reagents>Organic Building Blocks> 6-Chloro-5-(trifluoromethyl)pyridine-3-sulfonamide
For research use only. Not for therapeutic Use.
6-Chloro-5-(trifluoromethyl)pyridine-3-sulfonamide(CAT: L035802) is a high-purity heterocyclic compound widely utilized in pharmaceutical research and agrochemical development. Featuring a chloro and trifluoromethyl-substituted pyridine ring with a sulfonamide group, it serves as a crucial intermediate for synthesizing bioactive molecules, enzyme inhibitors, and therapeutic agents. Its unique structure enhances metabolic stability and biological activity, making it valuable in medicinal chemistry and fluorine-based compound development. Known for its reactivity and versatility, 6-Chloro-5-(trifluoromethyl)pyridine-3-sulfonamide supports advanced chemical synthesis, enabling precision and efficiency in both academic and industrial research applications.
CAS Number | 1228875-16-8 |
Molecular Formula | C6H4ClF3N2O2S |
Purity | ≥95% |
IUPAC Name | 6-chloro-5-(trifluoromethyl)pyridine-3-sulfonamide |
InChI | InChI=1S/C6H4ClF3N2O2S/c7-5-4(6(8,9)10)1-3(2-12-5)15(11,13)14/h1-2H,(H2,11,13,14) |
InChIKey | AZUGNASGYNDTNJ-UHFFFAOYSA-N |
SMILES | C1=C(C=NC(=C1C(F)(F)F)Cl)S(=O)(=O)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |