For research use only. Not for therapeutic Use.
6-Chloro-3H-imidazo[4,5-c]pyridine(CAT: L040279) is a high-purity heterocyclic compound featuring a chlorine substitution on the imidazo[4,5-c]pyridine framework. This versatile molecule is widely used as an intermediate in pharmaceutical research, particularly in the synthesis of bioactive compounds such as kinase inhibitors, antiviral agents, and receptor modulators. Its well-defined structure and reactivity make it a valuable building block for drug discovery and development. 6-Chloro-3H-imidazo[4,5-c]pyridine supports innovation in medicinal chemistry and fine chemical production, offering consistent performance for diverse applications in advanced chemical synthesis and research.
| CAS Number | 2589-11-9 |
| Molecular Formula | C6H4ClN3 |
| Purity | ≥95% |
| IUPAC Name | 6-chloro-3H-imidazo[4,5-c]pyridine |
| InChI | InChI=1S/C6H4ClN3/c7-6-1-4-5(2-8-6)10-3-9-4/h1-3H,(H,9,10) |
| InChIKey | GDXABUJCXZZPBI-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CN=C1Cl)NC=N2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |