For research use only. Not for therapeutic Use.
6-Chloro-2-methoxynicotinaldehyde(Cat No.:L029954)is a heteroaromatic compound derived from nicotinaldehyde, featuring a chlorine atom at the 6-position and a methoxy group at the 2-position of the pyridine ring. The aldehyde functionality at the 3-position enables nucleophilic addition and condensation reactions, making this molecule a versatile intermediate in pharmaceutical and agrochemical synthesis. Its electron-withdrawing and electron-donating substituents influence the ring’s reactivity, facilitating selective functionalization. 6-Chloro-2-methoxynicotinaldehyde is often employed in the development of bioactive heterocycles, coordination ligands, and building blocks for drug discovery and advanced material applications.
| CAS Number | 95652-81-6 |
| Molecular Formula | C7H6ClNO2 |
| Purity | ≥95% |
| IUPAC Name | 6-chloro-2-methoxypyridine-3-carbaldehyde |
| InChI | InChI=1S/C7H6ClNO2/c1-11-7-5(4-10)2-3-6(8)9-7/h2-4H,1H3 |
| InChIKey | AVBARORPQMEWPR-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=N1)Cl)C=O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |