For research use only. Not for therapeutic Use.
6-Chloro-2-iodo-4-methylpyridin-3-amine (Cat.No:L003345) is a significant chemical compound in pharmaceutical research. Its distinctive structure and reactivity make it a valuable scaffold for the development of novel pharmaceutical agents, highlighting its importance in modern drug discovery.
| CAS Number | 1073182-74-7 |
| Molecular Formula | C6H6ClIN2 |
| Purity | ≥95% |
| IUPAC Name | 6-chloro-2-iodo-4-methylpyridin-3-amine |
| InChI | InChI=1S/C6H6ClIN2/c1-3-2-4(7)10-6(8)5(3)9/h2H,9H2,1H3 |
| InChIKey | IOUXPZAGBJPWRP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=C1N)I)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
