For research use only. Not for therapeutic Use.
6-Chloro-1,3-dihydro-2H-pyrrolo[3,2-c]pyridin-2-one(Cat No.:L041277)is a chlorinated, fused heterocyclic compound incorporating a lactam (pyridone) core. The 6-chloro substitution enhances its electronic properties and reactivity, making it a valuable intermediate in medicinal chemistry. Its rigid, planar structure mimics purine-like scaffolds, allowing it to engage in hydrogen bonding and π-stacking interactions, which are critical in drug-target binding. This compound is commonly used in the synthesis of kinase inhibitors, anti-inflammatory agents, and central nervous system (CNS)-active compounds. It also serves as a core scaffold in the development of bioactive heterocyclic libraries for pharmaceutical research.
CAS Number | 1000342-80-2 |
Molecular Formula | C7H5ClN2O |
Purity | ≥95% |
IUPAC Name | 6-chloro-1,3-dihydropyrrolo[3,2-c]pyridin-2-one |
InChI | InChI=1S/C7H5ClN2O/c8-6-2-5-4(3-9-6)1-7(11)10-5/h2-3H,1H2,(H,10,11) |
InChIKey | RHUOLXNCHDDKTB-UHFFFAOYSA-N |
SMILES | C1C2=CN=C(C=C2NC1=O)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |