For research use only. Not for therapeutic Use.
6-Bromobenzyl isovanillin is a versatile chemical compound used in pharmaceutical and biochemical research. Featuring a bromobenzyl group attached to an isovanillin structure, this compound plays a critical role in the synthesis of bioactive molecules. Its distinct molecular configuration makes it valuable for studies involving enzyme inhibition, molecular docking, and drug design. 6-Bromobenzyl isovanillin is particularly useful in exploring aromatic compound interactions and serves as an intermediate in organic synthesis and medicinal chemistry applications.
| CAS Number | 6451-86-1 |
| Molecular Formula | C15H13BrO3 |
| Purity | ≥95% |
| IUPAC Name | 2-bromo-4-methoxy-5-phenylmethoxybenzaldehyde |
| InChI | InChI=1S/C15H13BrO3/c1-18-14-8-13(16)12(9-17)7-15(14)19-10-11-5-3-2-4-6-11/h2-9H,10H2,1H3 |
| InChIKey | RUBXMEDWBCBLEZ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)Br)C=O)OCC2=CC=CC=C2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |