Home
>
Chemical Reagents>Heterocyclic Building Blocks> 6-Bromo-8-fluoro-3,4-dihydroisoquinolin-1(2H)-one
For research use only. Not for therapeutic Use.
6-Bromo-8-fluoro-3,4-dihydroisoquinolin-1(2H)-one(Cat No.:L038538)is a heterocyclic compound used as a key intermediate in the synthesis of pharmaceuticals and biologically active molecules. The combination of bromine and fluorine atoms on the dihydroisoquinolinone core enhances its chemical reactivity, allowing for selective functionalization and modification in drug development. This compound is particularly valuable in creating molecules with potential activity in central nervous system disorders, cancer treatment, and other therapeutic areas. Its unique structure makes it a crucial building block in medicinal chemistry and advanced organic synthesis.
| CAS Number | 1242157-15-8 |
| Molecular Formula | C9H7BrFNO |
| Purity | ≥95% |
| IUPAC Name | 6-bromo-8-fluoro-3,4-dihydro-2H-isoquinolin-1-one |
| InChI | InChI=1S/C9H7BrFNO/c10-6-3-5-1-2-12-9(13)8(5)7(11)4-6/h3-4H,1-2H2,(H,12,13) |
| InChIKey | QNEGTSCEMNYFFK-UHFFFAOYSA-N |
| SMILES | C1CNC(=O)C2=C1C=C(C=C2F)Br |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |