For research use only. Not for therapeutic Use.
6-Bromo-4-fluoroisoindoline(Cat No.:L033681)is a halogenated heterocyclic compound used in pharmaceutical research and organic synthesis. This molecule features an isoindoline core with a bromine atom at the 6-position and a fluorine atom at the 4-position, making it a valuable intermediate for creating complex bioactive molecules. It is particularly useful in the development of potential therapeutic agents, where its halogenated structure allows for diverse chemical modifications. The compound’s unique reactivity supports advanced research in medicinal chemistry, enabling the design of novel drugs and functional materials.
CAS Number | 689214-92-4 |
Molecular Formula | C8H7BrFN |
Purity | ≥95% |
IUPAC Name | 6-bromo-4-fluoro-2,3-dihydro-1H-isoindole |
InChI | InChI=1S/C8H7BrFN/c9-6-1-5-3-11-4-7(5)8(10)2-6/h1-2,11H,3-4H2 |
InChIKey | ZOJUKIHIUSKTED-UHFFFAOYSA-N |
SMILES | C1C2=C(CN1)C(=CC(=C2)Br)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |