For research use only. Not for therapeutic Use.
6-Bromo-4-fluoro-1-methyl-1H-indazole (Cat.No:L003559) is a significant chemical compound with versatile applications in pharmaceutical research. Its unique structural features and halogen substitution pattern make it a valuable scaffold for the development of biologically active molecules.
| CAS Number | 1358574-94-3 |
| Molecular Formula | C8H6BrFN2 |
| Purity | ≥95% |
| IUPAC Name | 6-bromo-4-fluoro-1-methylindazole |
| InChI | InChI=1S/C8H6BrFN2/c1-12-8-3-5(9)2-7(10)6(8)4-11-12/h2-4H,1H3 |
| InChIKey | FNYZGEXFMJWTLU-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=N1)C(=CC(=C2)Br)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |