For research use only. Not for therapeutic Use.
6-Bromo-3,4-dihydro-4,4-dimethyl-2H-1-benzothiopyran(Cat No.:M133535)is a sulfur-containing heterocyclic compound featuring a benzothiopyran core with bromine substitution at the 6-position and two methyl groups at the 4-position. The partially saturated pyran ring provides structural flexibility, while the bromine atom offers a reactive site for cross-coupling reactions such as Suzuki or Heck, enabling further functionalization. Its unique combination of aromatic, sulfur, and halogen components makes it a valuable intermediate in pharmaceutical and agrochemical research, particularly for synthesizing bioactive molecules, including enzyme inhibitors and ligands with potential therapeutic properties.
| CAS Number | 112110-44-8 |
| Molecular Formula | C11H13BrS |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 6-bromo-4,4-dimethyl-2,3-dihydrothiochromene |
| InChI | InChI=1S/C11H13BrS/c1-11(2)5-6-13-10-4-3-8(12)7-9(10)11/h3-4,7H,5-6H2,1-2H3 |
| InChIKey | FLNJCJQFSGXLIR-UHFFFAOYSA-N |
| SMILES | CC1(CCSC2=C1C=C(C=C2)Br)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |