For research use only. Not for therapeutic Use.
6-Bromo-2-methyl-1,2,3,4-tetrahydroquinoline (Cat.No:L003633) is a notable chemical compound with diverse applications. Its unique structure makes it a valuable building block in the synthesis of pharmaceuticals and agrochemicals. This compound’s versatile reactivity and biological activity highlight its significance in the field of medicinal chemistry.
CAS Number | 42835-98-3 |
Molecular Formula | C10H12BrN |
Purity | ≥95% |
IUPAC Name | 6-bromo-2-methyl-1,2,3,4-tetrahydroquinoline |
InChI | InChI=1S/C10H12BrN/c1-7-2-3-8-6-9(11)4-5-10(8)12-7/h4-7,12H,2-3H2,1H3 |
InChIKey | QWGAZLNZSGHSGE-UHFFFAOYSA-N |
SMILES | CC1CCC2=C(N1)C=CC(=C2)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |