For research use only. Not for therapeutic Use.
6-Bromo-[1,2,4]triazolo[4,3-a]pyridin-3(2H)-one is a heterocyclic compound featuring a bromine atom at the 6-position of a fused triazole and pyridine structure. This compound is of interest in medicinal chemistry for its potential biological activities, including antimicrobial and antitumor properties. The bromine substitution enhances its reactivity, enabling various chemical transformations. Its unique structure allows for further functionalization, making it valuable for the development of novel therapeutic agents and in the synthesis of bioactive compounds in drug discovery.
CAS Number | 425702-91-6 |
Molecular Formula | C6H4BrN3O |
Purity | ≥95% |
IUPAC Name | 6-bromo-2H-[1,2,4]triazolo[4,3-a]pyridin-3-one |
InChI | InChI=1S/C6H4BrN3O/c7-4-1-2-5-8-9-6(11)10(5)3-4/h1-3H,(H,9,11) |
InChIKey | KZVFUYHFHBBPPD-UHFFFAOYSA-N |
SMILES | C1=CC2=NNC(=O)N2C=C1Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |