For research use only, not for therapeutic use.
6-Bromo-[1,2,4]triazolo[1,5-A]pyrimidine(Cat No.:L028535)is a brominated heterocyclic compound widely used in pharmaceutical and chemical research. This compound features a bromine atom at the 6-position on the triazolopyrimidine ring, making it a valuable building block in the synthesis of bioactive molecules, including potential drug candidates. Its unique structure allows for versatile chemical transformations, particularly in the development of inhibitors, antivirals, and other therapeutic agents. 6-Bromo-[1,2,4]triazolo[1,5-A]pyrimidine is essential for researchers focused on innovative synthetic methodologies and advancing medicinal chemistry.
Catalog Number | L028535 |
CAS Number | 89167-24-8 |
Molecular Formula | C5H3BrN4 |
Purity | ≥95% |
IUPAC Name | 6-bromo-[1,2,4]triazolo[1,5-a]pyrimidine |
InChI | InChI=1S/C5H3BrN4/c6-4-1-7-5-8-3-9-10(5)2-4/h1-3H |
InChIKey | VEPBELSFCORKNT-UHFFFAOYSA-N |
SMILES | C1=C(C=NC2=NC=NN21)Br |