For research use only. Not for therapeutic Use.
6-Bromo-1-chloroisoquinoline(CAT: R029142) is a versatile halogenated heterocycle used as a key intermediate in organic and medicinal chemistry. With bromine at position 6 and chlorine at position 1 on the isoquinoline ring, it offers two distinct reactive sites for palladium-catalyzed cross-coupling reactions, such as Suzuki, Stille, or Buchwald–Hartwig aminations. This dual halogenation enables the stepwise introduction of aryl, alkyl, or amine groups, making it valuable in the synthesis of complex nitrogen-containing scaffolds, pharmaceutical candidates, and heterocyclic libraries. The isoquinoline core is pharmacologically relevant, often found in bioactive molecules.
| CAS Number | 205055-63-6 |
| Synonyms | 1-Chloro-6-bromoisoquinoline |
| Molecular Formula | C9H5BrClN |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 6-bromo-1-chloroisoquinoline |
| InChI | InChI=1S/C9H5BrClN/c10-7-1-2-8-6(5-7)3-4-12-9(8)11/h1-5H |
| InChIKey | VOAHGGQULSSGQW-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CN=C2Cl)C=C1Br |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |